C8H5F2NO5 — CID 125129452
(2S)-2-(2,3-difluoro-5-nitrophenyl)-2-hydroxyacetic acid (PubChem CID 125129452) has the molecular formula C8H5F2NO5 and a molecular weight of 233.13 g/mol. Its IUPAC name is (2S)-2-(2,3-difluoro-5-nitrophenyl)-2-hydroxyacetic acid.
| Compound Name | (2S)-2-(2,3-difluoro-5-nitrophenyl)-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 125129452 |
| Molecular Formula | C8H5F2NO5 |
| Molecular Weight | 233.13 g/mol |
| Exact Mass | 233.01 |
| IUPAC Name | (2S)-2-(2,3-difluoro-5-nitrophenyl)-2-hydroxyacetic acid |
| SMILES | O=C(O)[C@@H](O)c1cc([N+](=O)[O-])cc(F)c1F |
| InChI | InChI=1S/C8H5F2NO5/c9-5-2-3(11(15)16)1-4(6(5)10)7(12)8(13)14/h1-2,7,12H,(H,13,14)/t7-/m0/s1 |
| InChIKey | LDQVMMJHCGQDNP-ZETCQYMHSA-N |
| XLogP | 0.99 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.13 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|