C8H6N2O7 — CID 166610284
2-(2,4-dinitrophenyl)-2-hydroxyacetic acid (PubChem CID 166610284) has the molecular formula C8H6N2O7 and a molecular weight of 242.14 g/mol. Its IUPAC name is 2-(2,4-dinitrophenyl)-2-hydroxyacetic acid.
| Compound Name | 2-(2,4-dinitrophenyl)-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 166610284 |
| Molecular Formula | C8H6N2O7 |
| Molecular Weight | 242.14 g/mol |
| Exact Mass | 242.02 |
| IUPAC Name | 2-(2,4-dinitrophenyl)-2-hydroxyacetic acid |
| SMILES | O=C(O)C(O)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H6N2O7/c11-7(8(12)13)5-2-1-4(9(14)15)3-6(5)10(16)17/h1-3,7,11H,(H,12,13) |
| InChIKey | BWQITYAOJPWJEL-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 143.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.14 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|