2-(2,4-dinitrophenyl)-2-hydroxyacetic acid

C8H6N2O7 — CID 166610284

IUPAC2-(2,4-dinitrophenyl)-2-hydroxyacetic acid
SMILESO=C(O)C(O)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-]
InChIInChI=1S/C8H6N2O7/c11-7(8(12)13)5-2-1-4(9(14)15)3-6(5)10(16)17/h1-3,7,11H,(H,12,13)
InChIKeyBWQITYAOJPWJEL-UHFFFAOYSA-N
MW242.14 g/mol
LogP0.62
Rot. Bonds4

About 2-(2,4-dinitrophenyl)-2-hydroxyacetic acid

2-(2,4-dinitrophenyl)-2-hydroxyacetic acid (PubChem CID 166610284) has the molecular formula C8H6N2O7 and a molecular weight of 242.14 g/mol. Its IUPAC name is 2-(2,4-dinitrophenyl)-2-hydroxyacetic acid.

Molecular Properties

Compound Name2-(2,4-dinitrophenyl)-2-hydroxyacetic acid
PubChem CID166610284
Molecular FormulaC8H6N2O7
Molecular Weight242.14 g/mol
Exact Mass242.02
IUPAC Name2-(2,4-dinitrophenyl)-2-hydroxyacetic acid
SMILESO=C(O)C(O)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-]
InChIInChI=1S/C8H6N2O7/c11-7(8(12)13)5-2-1-4(9(14)15)3-6(5)10(16)17/h1-3,7,11H,(H,12,13)
InChIKeyBWQITYAOJPWJEL-UHFFFAOYSA-N
XLogP0.62
TPSA143.81 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500242.14
LogP ≤ 50.62
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-(2,4-dinitrophenyl)-2-hydroxyacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,4-dinitrophenyl)-2-hydroxyacetic acid?
The IUPAC name of 2-(2,4-dinitrophenyl)-2-hydroxyacetic acid (CID 166610284) is 2-(2,4-dinitrophenyl)-2-hydroxyacetic acid.
What is the SMILES notation for 2-(2,4-dinitrophenyl)-2-hydroxyacetic acid?
The canonical SMILES for 2-(2,4-dinitrophenyl)-2-hydroxyacetic acid is O=C(O)C(O)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-].
What is the InChIKey of 2-(2,4-dinitrophenyl)-2-hydroxyacetic acid?
The InChIKey is BWQITYAOJPWJEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O7/c11-7(8(12)13)5-2-1-4(9(14)15)3-6(5)10(16)17/h1-3,7,11H,(H,12,13).
What are the key properties of 2-(2,4-dinitrophenyl)-2-hydroxyacetic acid?
2-(2,4-dinitrophenyl)-2-hydroxyacetic acid has a molecular weight of 242.14 g/mol, XLogP of 0.62, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dinitrophenyl)-2-hydroxyacetic acid is sourced from PubChem (CID 166610284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).