C7H4F2N2O4 — CID 154791323
1-(difluoromethyl)-2,4-dinitrobenzene (PubChem CID 154791323) has the molecular formula C7H4F2N2O4 and a molecular weight of 218.12 g/mol. Its IUPAC name is 1-(difluoromethyl)-2,4-dinitrobenzene.
| Compound Name | 1-(difluoromethyl)-2,4-dinitrobenzene |
|---|---|
| PubChem CID | 154791323 |
| Molecular Formula | C7H4F2N2O4 |
| Molecular Weight | 218.12 g/mol |
| Exact Mass | 218.01 |
| IUPAC Name | 1-(difluoromethyl)-2,4-dinitrobenzene |
| SMILES | O=[N+]([O-])c1ccc(C(F)F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C7H4F2N2O4/c8-7(9)5-2-1-4(10(12)13)3-6(5)11(14)15/h1-3,7H |
| InChIKey | DPUPDCWUGMLKLN-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.12 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|