C13H16N2O4 — CID 101449692
1-[(E)-3-methylhex-4-en-2-yl]-2,4-dinitrobenzene (PubChem CID 101449692) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is 1-[(E)-3-methylhex-4-en-2-yl]-2,4-dinitrobenzene.
| Compound Name | 1-[(E)-3-methylhex-4-en-2-yl]-2,4-dinitrobenzene |
|---|---|
| PubChem CID | 101449692 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 1-[(E)-3-methylhex-4-en-2-yl]-2,4-dinitrobenzene |
| SMILES | C/C=C/C(C)C(C)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H16N2O4/c1-4-5-9(2)10(3)12-7-6-11(14(16)17)8-13(12)15(18)19/h4-10H,1-3H3/b5-4+ |
| InChIKey | MUSQADOAJOAXPW-SNAWJCMRSA-N |
| XLogP | 3.82 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|