C22H14Cl4N4O8 — CID 99844691
1-[(1S,2R)-1,2-dichloro-2-[4-[(1R,2S)-1,2-dichloro-2-(2,4-dinitrophenyl)ethyl]phenyl]ethyl]-2,4-dinitrobenzene (PubChem CID 99844691) has the molecular formula C22H14Cl4N4O8 and a molecular weight of 604.19 g/mol. Its IUPAC name is 1-[(1S,2R)-1,2-dichloro-2-[4-[(1R,2S)-1,2-dichloro-2-(2,4-dinitrophenyl)ethyl]phenyl]ethyl]-2,4-dinitrobenzene.
| Compound Name | 1-[(1S,2R)-1,2-dichloro-2-[4-[(1R,2S)-1,2-dichloro-2-(2,4-dinitrophenyl)ethyl]phenyl]ethyl]-2,4-dinitrobenzene |
|---|---|
| PubChem CID | 99844691 |
| Molecular Formula | C22H14Cl4N4O8 |
| Molecular Weight | 604.19 g/mol |
| Exact Mass | 601.96 |
| IUPAC Name | 1-[(1S,2R)-1,2-dichloro-2-[4-[(1R,2S)-1,2-dichloro-2-(2,4-dinitrophenyl)ethyl]phenyl]ethyl]-2,4-dinitrobenzene |
| SMILES | O=[N+]([O-])c1ccc([C@H](Cl)[C@H](Cl)c2ccc([C@@H](Cl)[C@@H](Cl)c3ccc([N+](=O)[O-])cc3[N+](=O)[O-])cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H14Cl4N4O8/c23-19(21(25)15-7-5-13(27(31)32)9-17(15)29(35)36)11-1-2-12(4-3-11)20(24)22(26)16-8-6-14(28(33)34)10-18(16)30(37)38/h1-10,19-22H/t19-,20-,21+,22+/m1/s1 |
| InChIKey | LYNBJUDBJRYFET-CZYKHXBRSA-N |
| XLogP | 7.84 |
| TPSA | 172.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.19 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|