C24H14Cl4N4O4 — CID 100805637
4-[(1S,2R)-1,2-dichloro-2-[3-[(1R,2R)-1,2-dichloro-2-(4-cyano-2-nitrophenyl)ethyl]phenyl]ethyl]-3-nitrobenzonitrile (PubChem CID 100805637) has the molecular formula C24H14Cl4N4O4 and a molecular weight of 564.21 g/mol. Its IUPAC name is 4-[(1S,2R)-1,2-dichloro-2-[3-[(1R,2R)-1,2-dichloro-2-(4-cyano-2-nitrophenyl)ethyl]phenyl]ethyl]-3-nitrobenzonitrile.
| Compound Name | 4-[(1S,2R)-1,2-dichloro-2-[3-[(1R,2R)-1,2-dichloro-2-(4-cyano-2-nitrophenyl)ethyl]phenyl]ethyl]-3-nitrobenzonitrile |
|---|---|
| PubChem CID | 100805637 |
| Molecular Formula | C24H14Cl4N4O4 |
| Molecular Weight | 564.21 g/mol |
| Exact Mass | 561.98 |
| IUPAC Name | 4-[(1S,2R)-1,2-dichloro-2-[3-[(1R,2R)-1,2-dichloro-2-(4-cyano-2-nitrophenyl)ethyl]phenyl]ethyl]-3-nitrobenzonitrile |
| SMILES | N#Cc1ccc([C@@H](Cl)[C@H](Cl)c2cccc([C@@H](Cl)[C@@H](Cl)c3ccc(C#N)cc3[N+](=O)[O-])c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H14Cl4N4O4/c25-21(23(27)17-6-4-13(11-29)8-19(17)31(33)34)15-2-1-3-16(10-15)22(26)24(28)18-7-5-14(12-30)9-20(18)32(35)36/h1-10,21-24H/t21-,22-,23-,24+/m1/s1 |
| InChIKey | TYWNYRTWAKWVCN-YCAMKHIRSA-N |
| XLogP | 7.77 |
| TPSA | 133.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.21 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|