C11H6BrN3O4 — CID 106695323
4-(4-bromo-2,5-dioxopyrrolidin-3-yl)-3-nitrobenzonitrile (PubChem CID 106695323) has the molecular formula C11H6BrN3O4 and a molecular weight of 324.09 g/mol. Its IUPAC name is 4-(4-bromo-2,5-dioxopyrrolidin-3-yl)-3-nitrobenzonitrile.
| Compound Name | 4-(4-bromo-2,5-dioxopyrrolidin-3-yl)-3-nitrobenzonitrile |
|---|---|
| PubChem CID | 106695323 |
| Molecular Formula | C11H6BrN3O4 |
| Molecular Weight | 324.09 g/mol |
| Exact Mass | 322.95 |
| IUPAC Name | 4-(4-bromo-2,5-dioxopyrrolidin-3-yl)-3-nitrobenzonitrile |
| SMILES | N#Cc1ccc(C2C(=O)NC(=O)C2Br)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H6BrN3O4/c12-9-8(10(16)14-11(9)17)6-2-1-5(4-13)3-7(6)15(18)19/h1-3,8-9H,(H,14,16,17) |
| InChIKey | FYNHMZVNZIIYGZ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 113.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.09 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|