C22H16Cl2N2O4 — CID 7158817
1-[(1S,2S)-1,2-dichloro-2-phenylethyl]-2,4-dinitro-5-[(E)-2-phenylethenyl]benzene (PubChem CID 7158817) has the molecular formula C22H16Cl2N2O4 and a molecular weight of 443.29 g/mol. Its IUPAC name is 1-[(1S,2S)-1,2-dichloro-2-phenylethyl]-2,4-dinitro-5-[(E)-2-phenylethenyl]benzene.
| Compound Name | 1-[(1S,2S)-1,2-dichloro-2-phenylethyl]-2,4-dinitro-5-[(E)-2-phenylethenyl]benzene |
|---|---|
| PubChem CID | 7158817 |
| Molecular Formula | C22H16Cl2N2O4 |
| Molecular Weight | 443.29 g/mol |
| Exact Mass | 442.05 |
| IUPAC Name | 1-[(1S,2S)-1,2-dichloro-2-phenylethyl]-2,4-dinitro-5-[(E)-2-phenylethenyl]benzene |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c([C@H](Cl)[C@@H](Cl)c2ccccc2)cc1/C=C/c1ccccc1 |
| InChI | InChI=1S/C22H16Cl2N2O4/c23-21(16-9-5-2-6-10-16)22(24)18-13-17(12-11-15-7-3-1-4-8-15)19(25(27)28)14-20(18)26(29)30/h1-14,21-22H/b12-11+/t21-,22-/m0/s1 |
| InChIKey | YSMPRUOJLAHKGO-KFDAMUOLSA-N |
| XLogP | 6.93 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.29 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|