C22H15BrN2O4 — CID 51521282
1-[(E)-2-bromo-2-phenylethenyl]-2,4-dinitro-5-[(E)-2-phenylethenyl]benzene (PubChem CID 51521282) has the molecular formula C22H15BrN2O4 and a molecular weight of 451.28 g/mol. Its IUPAC name is 1-[(E)-2-bromo-2-phenylethenyl]-2,4-dinitro-5-[(E)-2-phenylethenyl]benzene.
| Compound Name | 1-[(E)-2-bromo-2-phenylethenyl]-2,4-dinitro-5-[(E)-2-phenylethenyl]benzene |
|---|---|
| PubChem CID | 51521282 |
| Molecular Formula | C22H15BrN2O4 |
| Molecular Weight | 451.28 g/mol |
| Exact Mass | 450.02 |
| IUPAC Name | 1-[(E)-2-bromo-2-phenylethenyl]-2,4-dinitro-5-[(E)-2-phenylethenyl]benzene |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(/C=C(/Br)c2ccccc2)cc1/C=C/c1ccccc1 |
| InChI | InChI=1S/C22H15BrN2O4/c23-20(17-9-5-2-6-10-17)14-19-13-18(12-11-16-7-3-1-4-8-16)21(24(26)27)15-22(19)25(28)29/h1-15H/b12-11+,20-14+ |
| InChIKey | IZUCMCYILUILLB-IZOCETQSSA-N |
| XLogP | 6.57 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.28 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|