C22H18N2O3 — CID 7053398
(2R,3S)-6-nitro-2-phenyl-5-[(E)-2-phenylethenyl]-2,3-dihydro-1H-indol-3-ol (PubChem CID 7053398) has the molecular formula C22H18N2O3 and a molecular weight of 358.40 g/mol. Its IUPAC name is (2R,3S)-6-nitro-2-phenyl-5-[(E)-2-phenylethenyl]-2,3-dihydro-1H-indol-3-ol.
| Compound Name | (2R,3S)-6-nitro-2-phenyl-5-[(E)-2-phenylethenyl]-2,3-dihydro-1H-indol-3-ol |
|---|---|
| PubChem CID | 7053398 |
| Molecular Formula | C22H18N2O3 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | (2R,3S)-6-nitro-2-phenyl-5-[(E)-2-phenylethenyl]-2,3-dihydro-1H-indol-3-ol |
| SMILES | O=[N+]([O-])c1cc2c(cc1/C=C/c1ccccc1)[C@H](O)[C@@H](c1ccccc1)N2 |
| InChI | InChI=1S/C22H18N2O3/c25-22-18-13-17(12-11-15-7-3-1-4-8-15)20(24(26)27)14-19(18)23-21(22)16-9-5-2-6-10-16/h1-14,21-23,25H/b12-11+/t21-,22+/m1/s1 |
| InChIKey | ITOQIWZOAQFVLF-LVIAPQIJSA-N |
| XLogP | 4.97 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|