C20H16N2O10S2 — CID 174306447
1,2-dinitrobenzene;3-(2-phenylethenyl)benzene-1,2-disulfonic acid (PubChem CID 174306447) has the molecular formula C20H16N2O10S2 and a molecular weight of 508.49 g/mol. Its IUPAC name is 1,2-dinitrobenzene;3-(2-phenylethenyl)benzene-1,2-disulfonic acid.
| Compound Name | 1,2-dinitrobenzene;3-(2-phenylethenyl)benzene-1,2-disulfonic acid |
|---|---|
| PubChem CID | 174306447 |
| Molecular Formula | C20H16N2O10S2 |
| Molecular Weight | 508.49 g/mol |
| Exact Mass | 508.02 |
| IUPAC Name | 1,2-dinitrobenzene;3-(2-phenylethenyl)benzene-1,2-disulfonic acid |
| SMILES | O=S(=O)(O)c1cccc(C=Cc2ccccc2)c1S(=O)(=O)O.O=[N+]([O-])c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H12O6S2.C6H4N2O4/c15-21(16,17)13-8-4-7-12(14(13)22(18,19)20)10-9-11-5-2-1-3-6-11;9-7(10)5-3-1-2-4-6(5)8(11)12/h1-10H,(H,15,16,17)(H,18,19,20);1-4H |
| InChIKey | AIOKKJYPYMSREJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 195.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.49 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|