C14H13NO3S — CID 11448748
2-[(E)-2-(4-aminophenyl)ethenyl]benzenesulfonic acid (PubChem CID 11448748) has the molecular formula C14H13NO3S and a molecular weight of 275.33 g/mol. Its IUPAC name is 2-[(E)-2-(4-aminophenyl)ethenyl]benzenesulfonic acid.
| Compound Name | 2-[(E)-2-(4-aminophenyl)ethenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 11448748 |
| Molecular Formula | C14H13NO3S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 2-[(E)-2-(4-aminophenyl)ethenyl]benzenesulfonic acid |
| SMILES | Nc1ccc(/C=C/c2ccccc2S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C14H13NO3S/c15-13-9-6-11(7-10-13)5-8-12-3-1-2-4-14(12)19(16,17)18/h1-10H,15H2,(H,16,17,18)/b8-5+ |
| InChIKey | FPJQJCMWFQFMPA-VMPITWQZSA-N |
| XLogP | 2.69 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|