C15H17NO8S2 — CID 158942714
2-nitrobenzenesulfonic acid;2,4,6-trimethylbenzenesulfonic acid (PubChem CID 158942714) has the molecular formula C15H17NO8S2 and a molecular weight of 403.43 g/mol. Its IUPAC name is 2-nitrobenzenesulfonic acid;2,4,6-trimethylbenzenesulfonic acid.
| Compound Name | 2-nitrobenzenesulfonic acid;2,4,6-trimethylbenzenesulfonic acid |
|---|---|
| PubChem CID | 158942714 |
| Molecular Formula | C15H17NO8S2 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | 2-nitrobenzenesulfonic acid;2,4,6-trimethylbenzenesulfonic acid |
| SMILES | Cc1cc(C)c(S(=O)(=O)O)c(C)c1.O=[N+]([O-])c1ccccc1S(=O)(=O)O |
| InChI | InChI=1S/C9H12O3S.C6H5NO5S/c1-6-4-7(2)9(8(3)5-6)13(10,11)12;8-7(9)5-3-1-2-4-6(5)13(10,11)12/h4-5H,1-3H3,(H,10,11,12);1-4H,(H,10,11,12) |
| InChIKey | JKLISSUXSSSJIG-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 151.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|