C14H13NO5S — CID 19386590
4-methyl-2-[(2-nitrophenyl)methyl]benzenesulfonic acid (PubChem CID 19386590) has the molecular formula C14H13NO5S and a molecular weight of 307.33 g/mol. Its IUPAC name is 4-methyl-2-[(2-nitrophenyl)methyl]benzenesulfonic acid.
| Compound Name | 4-methyl-2-[(2-nitrophenyl)methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 19386590 |
| Molecular Formula | C14H13NO5S |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 4-methyl-2-[(2-nitrophenyl)methyl]benzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)c(Cc2ccccc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H13NO5S/c1-10-6-7-14(21(18,19)20)12(8-10)9-11-4-2-3-5-13(11)15(16)17/h2-8H,9H2,1H3,(H,18,19,20) |
| InChIKey | KHUXFZLOHCESCK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 97.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|