C22H21NO6S — CID 54250419
4-methyl-2-[2-(3-nitro-4-phenylmethoxyphenyl)ethyl]benzenesulfonic acid (PubChem CID 54250419) has the molecular formula C22H21NO6S and a molecular weight of 427.48 g/mol. Its IUPAC name is 4-methyl-2-[2-(3-nitro-4-phenylmethoxyphenyl)ethyl]benzenesulfonic acid.
| Compound Name | 4-methyl-2-[2-(3-nitro-4-phenylmethoxyphenyl)ethyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 54250419 |
| Molecular Formula | C22H21NO6S |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | 4-methyl-2-[2-(3-nitro-4-phenylmethoxyphenyl)ethyl]benzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)c(CCc2ccc(OCc3ccccc3)c([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C22H21NO6S/c1-16-7-12-22(30(26,27)28)19(13-16)10-8-17-9-11-21(20(14-17)23(24)25)29-15-18-5-3-2-4-6-18/h2-7,9,11-14H,8,10,15H2,1H3,(H,26,27,28) |
| InChIKey | QWIQQEDGXAIEDW-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 106.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|