C17H20N2O5S — CID 87484487
2-[2-(N-ethyl-4-nitroanilino)ethyl]-4-methylbenzenesulfonic acid (PubChem CID 87484487) has the molecular formula C17H20N2O5S and a molecular weight of 364.42 g/mol. Its IUPAC name is 2-[2-(N-ethyl-4-nitroanilino)ethyl]-4-methylbenzenesulfonic acid.
| Compound Name | 2-[2-(N-ethyl-4-nitroanilino)ethyl]-4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 87484487 |
| Molecular Formula | C17H20N2O5S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 2-[2-(N-ethyl-4-nitroanilino)ethyl]-4-methylbenzenesulfonic acid |
| SMILES | CCN(CCc1cc(C)ccc1S(=O)(=O)O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H20N2O5S/c1-3-18(15-5-7-16(8-6-15)19(20)21)11-10-14-12-13(2)4-9-17(14)25(22,23)24/h4-9,12H,3,10-11H2,1-2H3,(H,22,23,24) |
| InChIKey | SMIXTNVDGCDPJY-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|