C20H37NO9P2S — CID 90358903
2-[3-[bis(diethoxyphosphorylmethyl)amino]propyl]-4-methylbenzenesulfonic acid (PubChem CID 90358903) has the molecular formula C20H37NO9P2S and a molecular weight of 529.53 g/mol. Its IUPAC name is 2-[3-[bis(diethoxyphosphorylmethyl)amino]propyl]-4-methylbenzenesulfonic acid.
| Compound Name | 2-[3-[bis(diethoxyphosphorylmethyl)amino]propyl]-4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 90358903 |
| Molecular Formula | C20H37NO9P2S |
| Molecular Weight | 529.53 g/mol |
| Exact Mass | 529.17 |
| IUPAC Name | 2-[3-[bis(diethoxyphosphorylmethyl)amino]propyl]-4-methylbenzenesulfonic acid |
| SMILES | CCOP(=O)(CN(CCCc1cc(C)ccc1S(=O)(=O)O)CP(=O)(OCC)OCC)OCC |
| InChI | InChI=1S/C20H37NO9P2S/c1-6-27-31(22,28-7-2)16-21(17-32(23,29-8-3)30-9-4)14-10-11-19-15-18(5)12-13-20(19)33(24,25)26/h12-13,15H,6-11,14,16-17H2,1-5H3,(H,24,25,26) |
| InChIKey | KJWTYHVACRCOAA-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 128.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.53 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|