C16H18N2O4S — CID 34107036
N,2,5-trimethyl-N-[(2-nitrophenyl)methyl]benzenesulfonamide (PubChem CID 34107036) has the molecular formula C16H18N2O4S and a molecular weight of 334.40 g/mol. Its IUPAC name is N,2,5-trimethyl-N-[(2-nitrophenyl)methyl]benzenesulfonamide.
| Compound Name | N,2,5-trimethyl-N-[(2-nitrophenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 34107036 |
| Molecular Formula | C16H18N2O4S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | N,2,5-trimethyl-N-[(2-nitrophenyl)methyl]benzenesulfonamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N(C)Cc2ccccc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H18N2O4S/c1-12-8-9-13(2)16(10-12)23(21,22)17(3)11-14-6-4-5-7-15(14)18(19)20/h4-10H,11H2,1-3H3 |
| InChIKey | WJFDGECFCYFEND-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|