C11H10ClN3O4S2 — CID 61045396
2-chloro-N-methyl-N-[(2-nitrophenyl)methyl]-1,3-thiazole-5-sulfonamide (PubChem CID 61045396) has the molecular formula C11H10ClN3O4S2 and a molecular weight of 347.81 g/mol. Its IUPAC name is 2-chloro-N-methyl-N-[(2-nitrophenyl)methyl]-1,3-thiazole-5-sulfonamide.
| Compound Name | 2-chloro-N-methyl-N-[(2-nitrophenyl)methyl]-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 61045396 |
| Molecular Formula | C11H10ClN3O4S2 |
| Molecular Weight | 347.81 g/mol |
| Exact Mass | 346.98 |
| IUPAC Name | 2-chloro-N-methyl-N-[(2-nitrophenyl)methyl]-1,3-thiazole-5-sulfonamide |
| SMILES | CN(Cc1ccccc1[N+](=O)[O-])S(=O)(=O)c1cnc(Cl)s1 |
| InChI | InChI=1S/C11H10ClN3O4S2/c1-14(21(18,19)10-6-13-11(12)20-10)7-8-4-2-3-5-9(8)15(16)17/h2-6H,7H2,1H3 |
| InChIKey | HILFKEPABXIRTJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 93.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.81 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|