C11H14N4O5S — CID 88503223
1-nitrotriazole;2,4,6-trimethylbenzenesulfonic acid (PubChem CID 88503223) has the molecular formula C11H14N4O5S and a molecular weight of 314.32 g/mol. Its IUPAC name is 1-nitrotriazole;2,4,6-trimethylbenzenesulfonic acid.
| Compound Name | 1-nitrotriazole;2,4,6-trimethylbenzenesulfonic acid |
|---|---|
| PubChem CID | 88503223 |
| Molecular Formula | C11H14N4O5S |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 1-nitrotriazole;2,4,6-trimethylbenzenesulfonic acid |
| SMILES | Cc1cc(C)c(S(=O)(=O)O)c(C)c1.O=[N+]([O-])n1ccnn1 |
| InChI | InChI=1S/C9H12O3S.C2H2N4O2/c1-6-4-7(2)9(8(3)5-6)13(10,11)12;7-6(8)5-2-1-3-4-5/h4-5H,1-3H3,(H,10,11,12);1-2H |
| InChIKey | VHZPJERWXXKOSK-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 128.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|