1-nitrotriazole;2,4,6-trimethylbenzenesulfonic acid

C11H14N4O5S — CID 88503223

IUPAC1-nitrotriazole;2,4,6-trimethylbenzenesulfonic acid
SMILESCc1cc(C)c(S(=O)(=O)O)c(C)c1.O=[N+]([O-])n1ccnn1
InChIInChI=1S/C9H12O3S.C2H2N4O2/c1-6-4-7(2)9(8(3)5-6)13(10,11)12;7-6(8)5-2-1-3-4-5/h4-5H,1-3H3,(H,10,11,12);1-2H
InChIKeyVHZPJERWXXKOSK-UHFFFAOYSA-N
MW314.32 g/mol
LogP1.18
Rot. Bonds2

About 1-nitrotriazole;2,4,6-trimethylbenzenesulfonic acid

1-nitrotriazole;2,4,6-trimethylbenzenesulfonic acid (PubChem CID 88503223) has the molecular formula C11H14N4O5S and a molecular weight of 314.32 g/mol. Its IUPAC name is 1-nitrotriazole;2,4,6-trimethylbenzenesulfonic acid.

Molecular Properties

Compound Name1-nitrotriazole;2,4,6-trimethylbenzenesulfonic acid
PubChem CID88503223
Molecular FormulaC11H14N4O5S
Molecular Weight314.32 g/mol
Exact Mass314.07
IUPAC Name1-nitrotriazole;2,4,6-trimethylbenzenesulfonic acid
SMILESCc1cc(C)c(S(=O)(=O)O)c(C)c1.O=[N+]([O-])n1ccnn1
InChIInChI=1S/C9H12O3S.C2H2N4O2/c1-6-4-7(2)9(8(3)5-6)13(10,11)12;7-6(8)5-2-1-3-4-5/h4-5H,1-3H3,(H,10,11,12);1-2H
InChIKeyVHZPJERWXXKOSK-UHFFFAOYSA-N
XLogP1.18
TPSA128.22 Ų
H-Bond Donors1
H-Bond Acceptors7
Rotatable Bonds2
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500314.32
LogP ≤ 51.18
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 1-nitrotriazole;2,4,6-trimethylbenzenesulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-nitrotriazole;2,4,6-trimethylbenzenesulfonic acid?
The IUPAC name of 1-nitrotriazole;2,4,6-trimethylbenzenesulfonic acid (CID 88503223) is 1-nitrotriazole;2,4,6-trimethylbenzenesulfonic acid.
What is the SMILES notation for 1-nitrotriazole;2,4,6-trimethylbenzenesulfonic acid?
The canonical SMILES for 1-nitrotriazole;2,4,6-trimethylbenzenesulfonic acid is Cc1cc(C)c(S(=O)(=O)O)c(C)c1.O=[N+]([O-])n1ccnn1.
What is the InChIKey of 1-nitrotriazole;2,4,6-trimethylbenzenesulfonic acid?
The InChIKey is VHZPJERWXXKOSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O3S.C2H2N4O2/c1-6-4-7(2)9(8(3)5-6)13(10,11)12;7-6(8)5-2-1-3-4-5/h4-5H,1-3H3,(H,10,11,12);1-2H.
What are the key properties of 1-nitrotriazole;2,4,6-trimethylbenzenesulfonic acid?
1-nitrotriazole;2,4,6-trimethylbenzenesulfonic acid has a molecular weight of 314.32 g/mol, XLogP of 1.18, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-nitrotriazole;2,4,6-trimethylbenzenesulfonic acid is sourced from PubChem (CID 88503223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).