C13H17Br2N4O3S+ — CID 175135698
3,5-dibromopyrazin-1-ium-1,2-diamine;2,4,6-trimethylbenzenesulfonic acid (PubChem CID 175135698) has the molecular formula C13H17Br2N4O3S+ and a molecular weight of 469.18 g/mol. Its IUPAC name is 3,5-dibromopyrazin-1-ium-1,2-diamine;2,4,6-trimethylbenzenesulfonic acid.
| Compound Name | 3,5-dibromopyrazin-1-ium-1,2-diamine;2,4,6-trimethylbenzenesulfonic acid |
|---|---|
| PubChem CID | 175135698 |
| Molecular Formula | C13H17Br2N4O3S+ |
| Molecular Weight | 469.18 g/mol |
| Exact Mass | 466.94 |
| IUPAC Name | 3,5-dibromopyrazin-1-ium-1,2-diamine;2,4,6-trimethylbenzenesulfonic acid |
| SMILES | Cc1cc(C)c(S(=O)(=O)O)c(C)c1.Nc1c(Br)nc(Br)c[n+]1N |
| InChI | InChI=1S/C9H12O3S.C4H4Br2N4/c1-6-4-7(2)9(8(3)5-6)13(10,11)12;5-2-1-10(8)4(7)3(6)9-2/h4-5H,1-3H3,(H,10,11,12);1,7H,8H2/p+1 |
| InChIKey | XPANCQUWYWUKKP-UHFFFAOYSA-O |
| XLogP | 2.05 |
| TPSA | 123.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.18 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|