C14H19N4O3S+ — CID 140828702
2-[(2-amino-3,6-dimethylpyrazin-1-ium-1-yl)amino]-4,6-dimethylbenzenesulfonic acid (PubChem CID 140828702) has the molecular formula C14H19N4O3S+ and a molecular weight of 323.40 g/mol. Its IUPAC name is 2-[(2-amino-3,6-dimethylpyrazin-1-ium-1-yl)amino]-4,6-dimethylbenzenesulfonic acid.
| Compound Name | 2-[(2-amino-3,6-dimethylpyrazin-1-ium-1-yl)amino]-4,6-dimethylbenzenesulfonic acid |
|---|---|
| PubChem CID | 140828702 |
| Molecular Formula | C14H19N4O3S+ |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 2-[(2-amino-3,6-dimethylpyrazin-1-ium-1-yl)amino]-4,6-dimethylbenzenesulfonic acid |
| SMILES | Cc1cc(C)c(S(=O)(=O)O)c(N[n+]2c(C)cnc(C)c2N)c1 |
| InChI | InChI=1S/C14H18N4O3S/c1-8-5-9(2)13(22(19,20)21)12(6-8)17-18-10(3)7-16-11(4)14(18)15/h5-7,15,17H,1-4H3,(H,19,20,21)/p+1 |
| InChIKey | LCHUCYWRRXFEHG-UHFFFAOYSA-O |
| XLogP | 1.31 |
| TPSA | 109.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|