C15H21N3O3S — CID 12633433
2,5-dimethylpyrazin-1-ium-1-amine;2,4,6-trimethylbenzenesulfonate (PubChem CID 12633433) has the molecular formula C15H21N3O3S and a molecular weight of 323.42 g/mol. Its IUPAC name is 2,5-dimethylpyrazin-1-ium-1-amine;2,4,6-trimethylbenzenesulfonate.
| Compound Name | 2,5-dimethylpyrazin-1-ium-1-amine;2,4,6-trimethylbenzenesulfonate |
|---|---|
| PubChem CID | 12633433 |
| Molecular Formula | C15H21N3O3S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 2,5-dimethylpyrazin-1-ium-1-amine;2,4,6-trimethylbenzenesulfonate |
| SMILES | Cc1c[n+](N)c(C)cn1.Cc1cc(C)c(S(=O)(=O)[O-])c(C)c1 |
| InChI | InChI=1S/C9H12O3S.C6H10N3/c1-6-4-7(2)9(8(3)5-6)13(10,11)12;1-5-4-9(7)6(2)3-8-5/h4-5H,1-3H3,(H,10,11,12);3-4H,1-2H3,(H2,7,8)/q;+1/p-1 |
| InChIKey | GZAYRQYFNCUALX-UHFFFAOYSA-M |
| XLogP | 1.22 |
| TPSA | 99.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|