C21H40N2O3S — CID 134983801
amino(tributyl)azanium;2,4,6-trimethylbenzenesulfonate (PubChem CID 134983801) has the molecular formula C21H40N2O3S and a molecular weight of 400.63 g/mol. Its IUPAC name is amino(tributyl)azanium;2,4,6-trimethylbenzenesulfonate.
| Compound Name | amino(tributyl)azanium;2,4,6-trimethylbenzenesulfonate |
|---|---|
| PubChem CID | 134983801 |
| Molecular Formula | C21H40N2O3S |
| Molecular Weight | 400.63 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | amino(tributyl)azanium;2,4,6-trimethylbenzenesulfonate |
| SMILES | CCCC[N+](N)(CCCC)CCCC.Cc1cc(C)c(S(=O)(=O)[O-])c(C)c1 |
| InChI | InChI=1S/C12H29N2.C9H12O3S/c1-4-7-10-14(13,11-8-5-2)12-9-6-3;1-6-4-7(2)9(8(3)5-6)13(10,11)12/h4-13H2,1-3H3;4-5H,1-3H3,(H,10,11,12)/q+1;/p-1 |
| InChIKey | VDLGGXSAZHEYPO-UHFFFAOYSA-M |
| XLogP | 4.59 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.63 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|