C12H14NO3S2- — CID 157407226
1,3-thiazole;2,4,6-trimethylbenzenesulfonate (PubChem CID 157407226) has the molecular formula C12H14NO3S2- and a molecular weight of 284.38 g/mol. Its IUPAC name is 1,3-thiazole;2,4,6-trimethylbenzenesulfonate.
| Compound Name | 1,3-thiazole;2,4,6-trimethylbenzenesulfonate |
|---|---|
| PubChem CID | 157407226 |
| Molecular Formula | C12H14NO3S2- |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 1,3-thiazole;2,4,6-trimethylbenzenesulfonate |
| SMILES | Cc1cc(C)c(S(=O)(=O)[O-])c(C)c1.c1cscn1 |
| InChI | InChI=1S/C9H12O3S.C3H3NS/c1-6-4-7(2)9(8(3)5-6)13(10,11)12;1-2-5-3-4-1/h4-5H,1-3H3,(H,10,11,12);1-3H/p-1 |
| InChIKey | RHHPIXZRHLLHBY-UHFFFAOYSA-M |
| XLogP | 2.66 |
| TPSA | 70.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|