C30H40O4S — CID 10391142
2,6-ditert-butyl-4-(3,5-dimethylphenyl)pyrylium;2,4,6-trimethylbenzenesulfonate (PubChem CID 10391142) has the molecular formula C30H40O4S and a molecular weight of 496.71 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-(3,5-dimethylphenyl)pyrylium;2,4,6-trimethylbenzenesulfonate.
| Compound Name | 2,6-ditert-butyl-4-(3,5-dimethylphenyl)pyrylium;2,4,6-trimethylbenzenesulfonate |
|---|---|
| PubChem CID | 10391142 |
| Molecular Formula | C30H40O4S |
| Molecular Weight | 496.71 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | 2,6-ditert-butyl-4-(3,5-dimethylphenyl)pyrylium;2,4,6-trimethylbenzenesulfonate |
| SMILES | Cc1cc(C)c(S(=O)(=O)[O-])c(C)c1.Cc1cc(C)cc(-c2cc(C(C)(C)C)[o+]c(C(C)(C)C)c2)c1 |
| InChI | InChI=1S/C21H29O.C9H12O3S/c1-14-9-15(2)11-16(10-14)17-12-18(20(3,4)5)22-19(13-17)21(6,7)8;1-6-4-7(2)9(8(3)5-6)13(10,11)12/h9-13H,1-8H3;4-5H,1-3H3,(H,10,11,12)/q+1;/p-1 |
| InChIKey | UWPWKSUJUYWEJW-UHFFFAOYSA-M |
| XLogP | 7.96 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.71 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|