2-methyl-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanoic acid

C13H19NO4S — CID 61263608

IUPAC2-methyl-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanoic acid
SMILESCc1cc(C)c(S(=O)(=O)NC(C)(C)C(=O)O)c(C)c1
InChIInChI=1S/C13H19NO4S/c1-8-6-9(2)11(10(3)7-8)19(17,18)14-13(4,5)12(15)16/h6-7,14H,1-5H3,(H,15,16)
InChIKeyPWNQWQDQLYQQPD-UHFFFAOYSA-N
MW285.37 g/mol
LogP1.75
Rot. Bonds4

About 2-methyl-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanoic acid

2-methyl-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanoic acid (PubChem CID 61263608) has the molecular formula C13H19NO4S and a molecular weight of 285.37 g/mol. Its IUPAC name is 2-methyl-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanoic acid.

Molecular Properties

Compound Name2-methyl-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanoic acid
PubChem CID61263608
Molecular FormulaC13H19NO4S
Molecular Weight285.37 g/mol
Exact Mass285.10
IUPAC Name2-methyl-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanoic acid
SMILESCc1cc(C)c(S(=O)(=O)NC(C)(C)C(=O)O)c(C)c1
InChIInChI=1S/C13H19NO4S/c1-8-6-9(2)11(10(3)7-8)19(17,18)14-13(4,5)12(15)16/h6-7,14H,1-5H3,(H,15,16)
InChIKeyPWNQWQDQLYQQPD-UHFFFAOYSA-N
XLogP1.75
TPSA83.47 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500285.37
LogP ≤ 51.75
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-methyl-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methyl-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanoic acid?
The IUPAC name of 2-methyl-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanoic acid (CID 61263608) is 2-methyl-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanoic acid.
What is the SMILES notation for 2-methyl-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanoic acid?
The canonical SMILES for 2-methyl-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanoic acid is Cc1cc(C)c(S(=O)(=O)NC(C)(C)C(=O)O)c(C)c1.
What is the InChIKey of 2-methyl-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanoic acid?
The InChIKey is PWNQWQDQLYQQPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO4S/c1-8-6-9(2)11(10(3)7-8)19(17,18)14-13(4,5)12(15)16/h6-7,14H,1-5H3,(H,15,16).
What are the key properties of 2-methyl-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanoic acid?
2-methyl-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanoic acid has a molecular weight of 285.37 g/mol, XLogP of 1.75, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanoic acid is sourced from PubChem (CID 61263608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).