C13H20N2O4S — CID 141030376
methyl 2-amino-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanoate (PubChem CID 141030376) has the molecular formula C13H20N2O4S and a molecular weight of 300.38 g/mol. Its IUPAC name is methyl 2-amino-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanoate.
| Compound Name | methyl 2-amino-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 141030376 |
| Molecular Formula | C13H20N2O4S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | methyl 2-amino-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanoate |
| SMILES | COC(=O)C(C)(N)NS(=O)(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C13H20N2O4S/c1-8-6-9(2)11(10(3)7-8)20(17,18)15-13(4,14)12(16)19-5/h6-7,15H,14H2,1-5H3 |
| InChIKey | LRCBMVUPWFIODB-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|