About methyl 2-amino-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanoate
methyl 2-amino-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanoate (PubChem CID 141030376) has the molecular formula C13H20N2O4S
and a molecular weight of 300.38 g/mol. Its IUPAC name is methyl 2-amino-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanoate.
Molecular Properties
| Compound Name | methyl 2-amino-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanoate |
| PubChem CID | 141030376 |
| Molecular Formula | C13H20N2O4S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | methyl 2-amino-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanoate |
| SMILES | COC(=O)C(C)(N)NS(=O)(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C13H20N2O4S/c1-8-6-9(2)11(10(3)7-8)20(17,18)15-13(4,14)12(16)19-5/h6-7,15H,14H2,1-5H3 |
| InChIKey | LRCBMVUPWFIODB-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-amino-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-amino-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanoate?
The IUPAC name of methyl 2-amino-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanoate (CID 141030376) is methyl 2-amino-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanoate.
What is the SMILES notation for methyl 2-amino-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanoate?
The canonical SMILES for methyl 2-amino-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanoate is COC(=O)C(C)(N)NS(=O)(=O)c1c(C)cc(C)cc1C.
What is the InChIKey of methyl 2-amino-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanoate?
The InChIKey is LRCBMVUPWFIODB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O4S/c1-8-6-9(2)11(10(3)7-8)20(17,18)15-13(4,14)12(16)19-5/h6-7,15H,14H2,1-5H3.
What are the key properties of methyl 2-amino-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanoate?
methyl 2-amino-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanoate has a molecular weight of 300.38 g/mol, XLogP of 0.74, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-amino-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanoate is sourced from PubChem (CID 141030376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).