C13H15NO4S — CID 13248131
prop-2-ynyl N-(2,4,6-trimethylphenyl)sulfonylcarbamate (PubChem CID 13248131) has the molecular formula C13H15NO4S and a molecular weight of 281.33 g/mol. Its IUPAC name is prop-2-ynyl N-(2,4,6-trimethylphenyl)sulfonylcarbamate.
| Compound Name | prop-2-ynyl N-(2,4,6-trimethylphenyl)sulfonylcarbamate |
|---|---|
| PubChem CID | 13248131 |
| Molecular Formula | C13H15NO4S |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | prop-2-ynyl N-(2,4,6-trimethylphenyl)sulfonylcarbamate |
| SMILES | C#CCOC(=O)NS(=O)(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C13H15NO4S/c1-5-6-18-13(15)14-19(16,17)12-10(3)7-9(2)8-11(12)4/h1,7-8H,6H2,2-4H3,(H,14,15) |
| InChIKey | URJONLOHFLHMKY-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|