C17H24N2O4 — CID 88764113
2-aminoacetic acid;prop-2-ynyl (2S)-2-(2,3,5-trimethylanilino)propanoate (PubChem CID 88764113) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is 2-aminoacetic acid;prop-2-ynyl (2S)-2-(2,3,5-trimethylanilino)propanoate.
| Compound Name | 2-aminoacetic acid;prop-2-ynyl (2S)-2-(2,3,5-trimethylanilino)propanoate |
|---|---|
| PubChem CID | 88764113 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 2-aminoacetic acid;prop-2-ynyl (2S)-2-(2,3,5-trimethylanilino)propanoate |
| SMILES | C#CCOC(=O)[C@H](C)Nc1cc(C)cc(C)c1C.NCC(=O)O |
| InChI | InChI=1S/C15H19NO2.C2H5NO2/c1-6-7-18-15(17)13(5)16-14-9-10(2)8-11(3)12(14)4;3-1-2(4)5/h1,8-9,13,16H,7H2,2-5H3;1,3H2,(H,4,5)/t13-;/m0./s1 |
| InChIKey | VWNYUKNDNGVRMY-ZOWNYOTGSA-N |
| XLogP | 1.62 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|