C18H30N2O5 — CID 70567868
2-aminoacetic acid;2-methoxyethyl (2S)-2-(2-ethyl-4,6-dimethylanilino)propanoate (PubChem CID 70567868) has the molecular formula C18H30N2O5 and a molecular weight of 354.45 g/mol. Its IUPAC name is 2-aminoacetic acid;2-methoxyethyl (2S)-2-(2-ethyl-4,6-dimethylanilino)propanoate.
| Compound Name | 2-aminoacetic acid;2-methoxyethyl (2S)-2-(2-ethyl-4,6-dimethylanilino)propanoate |
|---|---|
| PubChem CID | 70567868 |
| Molecular Formula | C18H30N2O5 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 2-aminoacetic acid;2-methoxyethyl (2S)-2-(2-ethyl-4,6-dimethylanilino)propanoate |
| SMILES | CCc1cc(C)cc(C)c1N[C@@H](C)C(=O)OCCOC.NCC(=O)O |
| InChI | InChI=1S/C16H25NO3.C2H5NO2/c1-6-14-10-11(2)9-12(3)15(14)17-13(4)16(18)20-8-7-19-5;3-1-2(4)5/h9-10,13,17H,6-8H2,1-5H3;1,3H2,(H,4,5)/t13-;/m0./s1 |
| InChIKey | IOBCDDBLJWPVHG-ZOWNYOTGSA-N |
| XLogP | 1.89 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|