C16H22ClN3O4 — CID 70568365
2-aminoacetic acid;2-cyanoethyl (2S)-2-(2-chloro-6-ethylanilino)propanoate (PubChem CID 70568365) has the molecular formula C16H22ClN3O4 and a molecular weight of 355.82 g/mol. Its IUPAC name is 2-aminoacetic acid;2-cyanoethyl (2S)-2-(2-chloro-6-ethylanilino)propanoate.
| Compound Name | 2-aminoacetic acid;2-cyanoethyl (2S)-2-(2-chloro-6-ethylanilino)propanoate |
|---|---|
| PubChem CID | 70568365 |
| Molecular Formula | C16H22ClN3O4 |
| Molecular Weight | 355.82 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 2-aminoacetic acid;2-cyanoethyl (2S)-2-(2-chloro-6-ethylanilino)propanoate |
| SMILES | CCc1cccc(Cl)c1N[C@@H](C)C(=O)OCCC#N.NCC(=O)O |
| InChI | InChI=1S/C14H17ClN2O2.C2H5NO2/c1-3-11-6-4-7-12(15)13(11)17-10(2)14(18)19-9-5-8-16;3-1-2(4)5/h4,6-7,10,17H,3,5,9H2,1-2H3;1,3H2,(H,4,5)/t10-;/m0./s1 |
| InChIKey | LPEZKWRFZFQOQG-PPHPATTJSA-N |
| XLogP | 2.19 |
| TPSA | 125.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.82 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|