C15H23ClN2O4 — CID 70566463
2-aminoacetic acid;2-chloroethyl (2S)-2-(2,6-dimethylanilino)propanoate (PubChem CID 70566463) has the molecular formula C15H23ClN2O4 and a molecular weight of 330.81 g/mol. Its IUPAC name is 2-aminoacetic acid;2-chloroethyl (2S)-2-(2,6-dimethylanilino)propanoate.
| Compound Name | 2-aminoacetic acid;2-chloroethyl (2S)-2-(2,6-dimethylanilino)propanoate |
|---|---|
| PubChem CID | 70566463 |
| Molecular Formula | C15H23ClN2O4 |
| Molecular Weight | 330.81 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 2-aminoacetic acid;2-chloroethyl (2S)-2-(2,6-dimethylanilino)propanoate |
| SMILES | Cc1cccc(C)c1N[C@@H](C)C(=O)OCCCl.NCC(=O)O |
| InChI | InChI=1S/C13H18ClNO2.C2H5NO2/c1-9-5-4-6-10(2)12(9)15-11(3)13(16)17-8-7-14;3-1-2(4)5/h4-6,11,15H,7-8H2,1-3H3;1,3H2,(H,4,5)/t11-;/m0./s1 |
| InChIKey | GDHYLKRRPHIFAC-MERQFXBCSA-N |
| XLogP | 1.92 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.81 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|