C13H16Cl3NO2 — CID 54313943
2,2,2-trichloroethyl (2S)-2-(2,6-dimethylanilino)propanoate (PubChem CID 54313943) has the molecular formula C13H16Cl3NO2 and a molecular weight of 324.64 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (2S)-2-(2,6-dimethylanilino)propanoate.
| Compound Name | 2,2,2-trichloroethyl (2S)-2-(2,6-dimethylanilino)propanoate |
|---|---|
| PubChem CID | 54313943 |
| Molecular Formula | C13H16Cl3NO2 |
| Molecular Weight | 324.64 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | 2,2,2-trichloroethyl (2S)-2-(2,6-dimethylanilino)propanoate |
| SMILES | Cc1cccc(C)c1N[C@@H](C)C(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C13H16Cl3NO2/c1-8-5-4-6-9(2)11(8)17-10(3)12(18)19-7-13(14,15)16/h4-6,10,17H,7H2,1-3H3/t10-/m0/s1 |
| InChIKey | SMVFPKBLICPIQD-JTQLQIEISA-N |
| XLogP | 4.02 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.64 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|