C15H21Cl3N2O4 — CID 70567541
2-aminoacetic acid;2,2,2-trichloroethyl (2S)-2-(2,3-dimethylanilino)propanoate (PubChem CID 70567541) has the molecular formula C15H21Cl3N2O4 and a molecular weight of 399.70 g/mol. Its IUPAC name is 2-aminoacetic acid;2,2,2-trichloroethyl (2S)-2-(2,3-dimethylanilino)propanoate.
| Compound Name | 2-aminoacetic acid;2,2,2-trichloroethyl (2S)-2-(2,3-dimethylanilino)propanoate |
|---|---|
| PubChem CID | 70567541 |
| Molecular Formula | C15H21Cl3N2O4 |
| Molecular Weight | 399.70 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | 2-aminoacetic acid;2,2,2-trichloroethyl (2S)-2-(2,3-dimethylanilino)propanoate |
| SMILES | Cc1cccc(N[C@@H](C)C(=O)OCC(Cl)(Cl)Cl)c1C.NCC(=O)O |
| InChI | InChI=1S/C13H16Cl3NO2.C2H5NO2/c1-8-5-4-6-11(9(8)2)17-10(3)12(18)19-7-13(14,15)16;3-1-2(4)5/h4-6,10,17H,7H2,1-3H3;1,3H2,(H,4,5)/t10-;/m0./s1 |
| InChIKey | VYVSAIMPFWYNLA-PPHPATTJSA-N |
| XLogP | 3.05 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.70 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|