C17H26N2O4 — CID 70567030
2-aminoacetic acid;prop-2-enyl (2S)-2-(2-ethyl-6-methylanilino)propanoate (PubChem CID 70567030) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is 2-aminoacetic acid;prop-2-enyl (2S)-2-(2-ethyl-6-methylanilino)propanoate.
| Compound Name | 2-aminoacetic acid;prop-2-enyl (2S)-2-(2-ethyl-6-methylanilino)propanoate |
|---|---|
| PubChem CID | 70567030 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 2-aminoacetic acid;prop-2-enyl (2S)-2-(2-ethyl-6-methylanilino)propanoate |
| SMILES | C=CCOC(=O)[C@H](C)Nc1c(C)cccc1CC.NCC(=O)O |
| InChI | InChI=1S/C15H21NO2.C2H5NO2/c1-5-10-18-15(17)12(4)16-14-11(3)8-7-9-13(14)6-2;3-1-2(4)5/h5,7-9,12,16H,1,6,10H2,2-4H3;1,3H2,(H,4,5)/t12-;/m0./s1 |
| InChIKey | GGSYVNTYTHEAOT-YDALLXLXSA-N |
| XLogP | 2.12 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|