C19H30N2O6 — CID 70568965
2-aminoacetic acid;(1-ethoxy-1-oxopropan-2-yl) (2S)-2-(2-ethyl-6-methylanilino)propanoate (PubChem CID 70568965) has the molecular formula C19H30N2O6 and a molecular weight of 382.46 g/mol. Its IUPAC name is 2-aminoacetic acid;(1-ethoxy-1-oxopropan-2-yl) (2S)-2-(2-ethyl-6-methylanilino)propanoate.
| Compound Name | 2-aminoacetic acid;(1-ethoxy-1-oxopropan-2-yl) (2S)-2-(2-ethyl-6-methylanilino)propanoate |
|---|---|
| PubChem CID | 70568965 |
| Molecular Formula | C19H30N2O6 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 2-aminoacetic acid;(1-ethoxy-1-oxopropan-2-yl) (2S)-2-(2-ethyl-6-methylanilino)propanoate |
| SMILES | CCOC(=O)C(C)OC(=O)[C@H](C)Nc1c(C)cccc1CC.NCC(=O)O |
| InChI | InChI=1S/C17H25NO4.C2H5NO2/c1-6-14-10-8-9-11(3)15(14)18-12(4)16(19)22-13(5)17(20)21-7-2;3-1-2(4)5/h8-10,12-13,18H,6-7H2,1-5H3;1,3H2,(H,4,5)/t12-,13?;/m0./s1 |
| InChIKey | GLJGDJCQFJNDIA-NQJMHYHOSA-N |
| XLogP | 1.88 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |