C11H15NO2 — CID 13138172
2-(2,3-dimethylanilino)propanoic acid (PubChem CID 13138172) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 2-(2,3-dimethylanilino)propanoic acid.
| Compound Name | 2-(2,3-dimethylanilino)propanoic acid |
|---|---|
| PubChem CID | 13138172 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 2-(2,3-dimethylanilino)propanoic acid |
| SMILES | Cc1cccc(NC(C)C(=O)O)c1C |
| InChI | InChI=1S/C11H15NO2/c1-7-5-4-6-10(8(7)2)12-9(3)11(13)14/h4-6,9,12H,1-3H3,(H,13,14) |
| InChIKey | VEUBQULGFGJNPI-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |