C12H19N3O4S — CID 91620907
(2S)-3-amino-2-[2-(2,4,6-trimethylphenyl)sulfonylhydrazinyl]propanoic acid (PubChem CID 91620907) has the molecular formula C12H19N3O4S and a molecular weight of 301.37 g/mol. Its IUPAC name is (2S)-3-amino-2-[2-(2,4,6-trimethylphenyl)sulfonylhydrazinyl]propanoic acid.
| Compound Name | (2S)-3-amino-2-[2-(2,4,6-trimethylphenyl)sulfonylhydrazinyl]propanoic acid |
|---|---|
| PubChem CID | 91620907 |
| Molecular Formula | C12H19N3O4S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | (2S)-3-amino-2-[2-(2,4,6-trimethylphenyl)sulfonylhydrazinyl]propanoic acid |
| SMILES | Cc1cc(C)c(S(=O)(=O)NN[C@@H](CN)C(=O)O)c(C)c1 |
| InChI | InChI=1S/C12H19N3O4S/c1-7-4-8(2)11(9(3)5-7)20(18,19)15-14-10(6-13)12(16)17/h4-5,10,14-15H,6,13H2,1-3H3,(H,16,17)/t10-/m0/s1 |
| InChIKey | WBSKHJRZEUFXAJ-JTQLQIEISA-N |
| XLogP | -0.19 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|