C13H22BNO3S — CID 156858995
CID 156858995 (PubChem CID 156858995) has the molecular formula C13H22BNO3S and a molecular weight of 283.20 g/mol.
| Compound Name | CID 156858995 |
|---|---|
| PubChem CID | 156858995 |
| Molecular Formula | C13H22BNO3S |
| Molecular Weight | 283.20 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | — |
| SMILES | CC.[B]CC(=O)NS(=O)(=O)c1c(C)cc(C)cc1C.[H][H] |
| InChI | InChI=1S/C11H14BNO3S.C2H6.H2/c1-7-4-8(2)11(9(3)5-7)17(15,16)13-10(14)6-12;1-2;/h4-5H,6H2,1-3H3,(H,13,14);1-2H3;1H |
| InChIKey | ROADJOSQSWLJIW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.20 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|