C16H27NO3S — CID 103835154
N-(3-ethyl-2-hydroxypentyl)-2,4,6-trimethylbenzenesulfonamide (PubChem CID 103835154) has the molecular formula C16H27NO3S and a molecular weight of 313.46 g/mol. Its IUPAC name is N-(3-ethyl-2-hydroxypentyl)-2,4,6-trimethylbenzenesulfonamide.
| Compound Name | N-(3-ethyl-2-hydroxypentyl)-2,4,6-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 103835154 |
| Molecular Formula | C16H27NO3S |
| Molecular Weight | 313.46 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | N-(3-ethyl-2-hydroxypentyl)-2,4,6-trimethylbenzenesulfonamide |
| SMILES | CCC(CC)C(O)CNS(=O)(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C16H27NO3S/c1-6-14(7-2)15(18)10-17-21(19,20)16-12(4)8-11(3)9-13(16)5/h8-9,14-15,17-18H,6-7,10H2,1-5H3 |
| InChIKey | IZKKGVXBHXQOJV-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.46 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |