C13H18BrCl2NO3S — CID 106288270
4-bromo-2,6-dichloro-N-(3-ethyl-2-hydroxypentyl)benzenesulfonamide (PubChem CID 106288270) has the molecular formula C13H18BrCl2NO3S and a molecular weight of 419.17 g/mol. Its IUPAC name is 4-bromo-2,6-dichloro-N-(3-ethyl-2-hydroxypentyl)benzenesulfonamide.
| Compound Name | 4-bromo-2,6-dichloro-N-(3-ethyl-2-hydroxypentyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106288270 |
| Molecular Formula | C13H18BrCl2NO3S |
| Molecular Weight | 419.17 g/mol |
| Exact Mass | 416.96 |
| IUPAC Name | 4-bromo-2,6-dichloro-N-(3-ethyl-2-hydroxypentyl)benzenesulfonamide |
| SMILES | CCC(CC)C(O)CNS(=O)(=O)c1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C13H18BrCl2NO3S/c1-3-8(4-2)12(18)7-17-21(19,20)13-10(15)5-9(14)6-11(13)16/h5-6,8,12,17-18H,3-4,7H2,1-2H3 |
| InChIKey | HQMUVNVKLCJTBN-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.17 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |