C13H22N2O3S — CID 64540008
N-(2-amino-3-hydroxybutyl)-2,4,6-trimethylbenzenesulfonamide (PubChem CID 64540008) has the molecular formula C13H22N2O3S and a molecular weight of 286.40 g/mol. Its IUPAC name is N-(2-amino-3-hydroxybutyl)-2,4,6-trimethylbenzenesulfonamide.
| Compound Name | N-(2-amino-3-hydroxybutyl)-2,4,6-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 64540008 |
| Molecular Formula | C13H22N2O3S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | N-(2-amino-3-hydroxybutyl)-2,4,6-trimethylbenzenesulfonamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)NCC(N)C(C)O)c(C)c1 |
| InChI | InChI=1S/C13H22N2O3S/c1-8-5-9(2)13(10(3)6-8)19(17,18)15-7-12(14)11(4)16/h5-6,11-12,15-16H,7,14H2,1-4H3 |
| InChIKey | WCCJYAXLFDSEPS-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |