C11H17N3O4S — CID 106165069
3-[(4-amino-2,6-dimethylphenyl)sulfonylamino]-2-hydroxypropanamide (PubChem CID 106165069) has the molecular formula C11H17N3O4S and a molecular weight of 287.34 g/mol. Its IUPAC name is 3-[(4-amino-2,6-dimethylphenyl)sulfonylamino]-2-hydroxypropanamide.
| Compound Name | 3-[(4-amino-2,6-dimethylphenyl)sulfonylamino]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 106165069 |
| Molecular Formula | C11H17N3O4S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 3-[(4-amino-2,6-dimethylphenyl)sulfonylamino]-2-hydroxypropanamide |
| SMILES | Cc1cc(N)cc(C)c1S(=O)(=O)NCC(O)C(N)=O |
| InChI | InChI=1S/C11H17N3O4S/c1-6-3-8(12)4-7(2)10(6)19(17,18)14-5-9(15)11(13)16/h3-4,9,14-15H,5,12H2,1-2H3,(H2,13,16) |
| InChIKey | WOPIUPHKKLDUHX-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 135.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|