C15H26N2O3S — CID 107150700
4-amino-N-(2-hydroxy-4,4-dimethylpentyl)-2,6-dimethylbenzenesulfonamide (PubChem CID 107150700) has the molecular formula C15H26N2O3S and a molecular weight of 314.45 g/mol. Its IUPAC name is 4-amino-N-(2-hydroxy-4,4-dimethylpentyl)-2,6-dimethylbenzenesulfonamide.
| Compound Name | 4-amino-N-(2-hydroxy-4,4-dimethylpentyl)-2,6-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 107150700 |
| Molecular Formula | C15H26N2O3S |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 4-amino-N-(2-hydroxy-4,4-dimethylpentyl)-2,6-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(N)cc(C)c1S(=O)(=O)NCC(O)CC(C)(C)C |
| InChI | InChI=1S/C15H26N2O3S/c1-10-6-12(16)7-11(2)14(10)21(19,20)17-9-13(18)8-15(3,4)5/h6-7,13,17-18H,8-9,16H2,1-5H3 |
| InChIKey | WPEQMNJGWXBAOZ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|