C15H25NO3S — CID 107155364
N-(2-hydroxy-4,4-dimethylpentyl)-3,5-dimethylbenzenesulfonamide (PubChem CID 107155364) has the molecular formula C15H25NO3S and a molecular weight of 299.44 g/mol. Its IUPAC name is N-(2-hydroxy-4,4-dimethylpentyl)-3,5-dimethylbenzenesulfonamide.
| Compound Name | N-(2-hydroxy-4,4-dimethylpentyl)-3,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 107155364 |
| Molecular Formula | C15H25NO3S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | N-(2-hydroxy-4,4-dimethylpentyl)-3,5-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(C)cc(S(=O)(=O)NCC(O)CC(C)(C)C)c1 |
| InChI | InChI=1S/C15H25NO3S/c1-11-6-12(2)8-14(7-11)20(18,19)16-10-13(17)9-15(3,4)5/h6-8,13,16-17H,9-10H2,1-5H3 |
| InChIKey | ZSZWVLLONRBXIQ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |