C13H19F2NO3S — CID 103835521
3,5-difluoro-N-(2-hydroxy-4,4-dimethylpentyl)benzenesulfonamide (PubChem CID 103835521) has the molecular formula C13H19F2NO3S and a molecular weight of 307.36 g/mol. Its IUPAC name is 3,5-difluoro-N-(2-hydroxy-4,4-dimethylpentyl)benzenesulfonamide.
| Compound Name | 3,5-difluoro-N-(2-hydroxy-4,4-dimethylpentyl)benzenesulfonamide |
|---|---|
| PubChem CID | 103835521 |
| Molecular Formula | C13H19F2NO3S |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 3,5-difluoro-N-(2-hydroxy-4,4-dimethylpentyl)benzenesulfonamide |
| SMILES | CC(C)(C)CC(O)CNS(=O)(=O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C13H19F2NO3S/c1-13(2,3)7-11(17)8-16-20(18,19)12-5-9(14)4-10(15)6-12/h4-6,11,16-17H,7-8H2,1-3H3 |
| InChIKey | RVNVYKPOSTVXPM-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |