C18H18N2O4S — CID 16578360
cyanomethyl 2-[(2,4,6-trimethylphenyl)sulfonylamino]benzoate (PubChem CID 16578360) has the molecular formula C18H18N2O4S and a molecular weight of 358.42 g/mol. Its IUPAC name is cyanomethyl 2-[(2,4,6-trimethylphenyl)sulfonylamino]benzoate.
| Compound Name | cyanomethyl 2-[(2,4,6-trimethylphenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 16578360 |
| Molecular Formula | C18H18N2O4S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | cyanomethyl 2-[(2,4,6-trimethylphenyl)sulfonylamino]benzoate |
| SMILES | Cc1cc(C)c(S(=O)(=O)Nc2ccccc2C(=O)OCC#N)c(C)c1 |
| InChI | InChI=1S/C18H18N2O4S/c1-12-10-13(2)17(14(3)11-12)25(22,23)20-16-7-5-4-6-15(16)18(21)24-9-8-19/h4-7,10-11,20H,9H2,1-3H3 |
| InChIKey | BDUCUOKKVLBGOL-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |