C31H34N4O5S2 — CID 170548860
1,3-bis[2-[(2,4,6-trimethylphenyl)sulfonylamino]phenyl]urea (PubChem CID 170548860) has the molecular formula C31H34N4O5S2 and a molecular weight of 606.77 g/mol. Its IUPAC name is 1,3-bis[2-[(2,4,6-trimethylphenyl)sulfonylamino]phenyl]urea.
| Compound Name | 1,3-bis[2-[(2,4,6-trimethylphenyl)sulfonylamino]phenyl]urea |
|---|---|
| PubChem CID | 170548860 |
| Molecular Formula | C31H34N4O5S2 |
| Molecular Weight | 606.77 g/mol |
| Exact Mass | 606.20 |
| IUPAC Name | 1,3-bis[2-[(2,4,6-trimethylphenyl)sulfonylamino]phenyl]urea |
| SMILES | Cc1cc(C)c(S(=O)(=O)Nc2ccccc2NC(=O)Nc2ccccc2NS(=O)(=O)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C31H34N4O5S2/c1-19-15-21(3)29(22(4)16-19)41(37,38)34-27-13-9-7-11-25(27)32-31(36)33-26-12-8-10-14-28(26)35-42(39,40)30-23(5)17-20(2)18-24(30)6/h7-18,34-35H,1-6H3,(H2,32,33,36) |
| InChIKey | ZKWRPXPWWHMOCE-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 133.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.77 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |