C28H29BrN2O4S2 — CID 5241230
N-[3-bromo-4-[(2,4,6-trimethylphenyl)sulfonylamino]naphthalen-1-yl]-2,4,6-trimethylbenzenesulfonamide (PubChem CID 5241230) has the molecular formula C28H29BrN2O4S2 and a molecular weight of 601.59 g/mol. Its IUPAC name is N-[3-bromo-4-[(2,4,6-trimethylphenyl)sulfonylamino]naphthalen-1-yl]-2,4,6-trimethylbenzenesulfonamide.
| Compound Name | N-[3-bromo-4-[(2,4,6-trimethylphenyl)sulfonylamino]naphthalen-1-yl]-2,4,6-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 5241230 |
| Molecular Formula | C28H29BrN2O4S2 |
| Molecular Weight | 601.59 g/mol |
| Exact Mass | 600.08 |
| IUPAC Name | N-[3-bromo-4-[(2,4,6-trimethylphenyl)sulfonylamino]naphthalen-1-yl]-2,4,6-trimethylbenzenesulfonamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)Nc2cc(Br)c(NS(=O)(=O)c3c(C)cc(C)cc3C)c3ccccc23)c(C)c1 |
| InChI | InChI=1S/C28H29BrN2O4S2/c1-16-11-18(3)27(19(4)12-16)36(32,33)30-25-15-24(29)26(23-10-8-7-9-22(23)25)31-37(34,35)28-20(5)13-17(2)14-21(28)6/h7-15,30-31H,1-6H3 |
| InChIKey | FZODLPUSEDXPIW-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.59 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_D(2)', 'substructure': 'N/A'} |
|---|